Mesembrinol is a pyrrolidine alkaloid that serves as an analytical reference standard for laboratory research purposes. It is a naturally occurring compound reported in Mesembryanthemum tortuosum and features a complex polycyclic structure with an alcohol group and ether functionalities.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Mesembrinol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-EICOSENE
analytical reference standard
N,N'-Diacetyl-L-cystine
analytical reference standard
[D-Asn5]-Oxytocin
analytical reference standard
(+/-)-11-Nor-9-Tetrahydrocannabinol-[d3]
analytical reference standard
4-Bromo-2-fluoroanisole
research compound
2,3,6-Trifluorobenzoic acid
Research reagent for chemical synthesis
3,5-diiodopyridin-2-amine
research compound
(2S)-2-[[(2R,3R)-3-[(2S)-1-[(3R,4S,5S)-4-[[(2S)-2-[[(2S)-2-[3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl-methylamino]-3-methylbutanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methoxy-5-methylheptanoyl]pyrrolidin-2-yl]-3-methoxy-2-methylpropanoyl]amino]-3-phenylpropanoic acid
ADC research reagent
(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol
KPMLOZVRLWHOBN-COXVUDFISA-N
CN1CC[C@]2([C@@H]1C[C@@H](CC2)O)C3=CC(=C(C=C3)OC)OC
Mesembrinol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.