P-Toluidine-d3 (methyl-d3) is a deuterium-labeled version of p-toluidine, where the methyl group hydrogen atoms are replaced with deuterium. It is primarily used as a research reagent in studies requiring isotopic labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
P-TOLUIDINE-D3 (METHYL-D3) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
5-Bromoisophthalic acid
Building block for chemical synthesis
L-Prolinol
Research reagent for peptide synthesis
(R)-(-)-1,2,3,4-Tetrahydro-1-naphthylamine
Research compound
(1S,2R)-(+)-2-Amino-1,2-diphenylethanol
research compound
P-TOLUIDINE-D9
Deuterated research reagent
4-Toluidine-d7 (Major)
deuterated research standard
P-Toluidine
Intermediate for dyes manufacture
4-(trideuteriomethyl)aniline
RZXMPPFPUUCRFN-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CC=C(C=C1)N
P-TOLUIDINE-D3 (METHYL-D3) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.