5-Bromoisophthalic acid is a brominated dicarboxylic acid used as a building block in chemical synthesis. It is commonly employed as a research reagent for the preparation of more complex organic compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 23351-91-9
L-Prolinol
Research reagent for peptide synthesis
(R)-(-)-1,2,3,4-Tetrahydro-1-naphthylamine
Research compound
(1S,2R)-(+)-2-Amino-1,2-diphenylethanol
research compound
Potassium allyltrifluoroborate
cross-coupling reagent
5-bromobenzene-1,3-dicarboxylic acid
JATKASGNRMGFSW-UHFFFAOYSA-N
C1=C(C=C(C=C1C(=O)O)Br)C(=O)O