2-Bromo-5-methoxybenzoic acid is a brominated aromatic carboxylic acid used as a pharmaceutical intermediate. Its structure features a benzoic acid core with a bromine atom at the 2-position and a methoxy group at the 5-position, making it a versatile building block for organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 22921-68-2
2-bromo-4-methoxybenzoic acid
research compound
4-Tritylaniline
Pharmaceutical intermediate for synthesis
2,4-THIAZOLIDINEDIONE
Pharmaceutical intermediate and research compound
(3aR,4R,6S,6aS)-Methyl 4-((tert-butoxycarbonyl)amino)-3-(pentan-3-yl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]isoxazole-6-carboxylate
Pharmaceutical intermediate for Peramivir
(1S,4R)-1-methyl-4-(prop-1-en-2-yl)cyclohex-2-en-1-ol
Lisdexamfetamine intermediate
2-bromo-5-methoxybenzoic acid
ODHJOROUCITYNF-UHFFFAOYSA-N
COC1=CC(=C(C=C1)Br)C(=O)O