4-Tritylaniline is a chemical compound featuring an aniline moiety attached to a triphenylmethyl (trityl) group, commonly utilized as a building block in organic synthesis. Its structure includes an amine group and multiple aromatic rings, contributing to its role as a pharmaceutical intermediate for manufacturing active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 22948-06-7
2,4-THIAZOLIDINEDIONE
Pharmaceutical intermediate and research compound
(3aR,4R,6S,6aS)-Methyl 4-((tert-butoxycarbonyl)amino)-3-(pentan-3-yl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]isoxazole-6-carboxylate
Pharmaceutical intermediate for Peramivir
(1S,4R)-1-methyl-4-(prop-1-en-2-yl)cyclohex-2-en-1-ol
Lisdexamfetamine intermediate
Cenobamate Impurity 24
Pharmaceutical impurity reference standard
Tetraphenylmethane
chemical building block
4-tritylaniline
XYHDHXBLSLSXSR-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=C(C=C4)N