This compound is a deuterated form of ethylene glycol, where all four hydrogen atoms on the carbon atoms are replaced with deuterium. It is primarily used as a deuterated solvent or reference standard in nuclear magnetic resonance (NMR) spectroscopy and other analytical applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 2219-51-4
Calcium;dibromide;dihydrate
Industrial chemical
3,5-Bis(trifluoromethyl)benzamide
Chemical intermediate for pharmaceutical synthesis
2-Butanone, O,O',O''-(ethenylsilylidyne)trioxime
crosslinking agent for silicone polymers
Phenol, 2,2',2''-(1,3,5-triazine-2,4,6-triyl)tris[5-(hexyloxy)-6-methyl-
UV absorber for plastics
Ethane-1,2-diol;2-hydroxyacetic acid
polyethylene glycol diacid precursor
에틸렌 글라이콜
antifreeze and polyester fiber raw material
(1,1,2,2-2H4)Ethane-1,2-(2H2)diol
deuterated NMR standard
1,1,2,2-tetradeuterioethane-1,2-diol
LYCAIKOWRPUZTN-LNLMKGTHSA-N
[2H]C([2H])(C([2H])([2H])O)O