This compound is a perdeuterated form of ethylene glycol, specifically labeled with deuterium atoms at all hydrogen positions. It is primarily used as a deuterated NMR standard in research laboratories for calibrating or referencing nuclear magnetic resonance experiments.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(1,1,2,2-2H4)Ethane-1,2-(2H2)diol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(2Z)-[(4S)-4-Phenyl-4,5-dihydro-1,3-oxazol-2-yl][(4S)-4-phenyl-1,3-oxazolidin-2-ylidene]acetonitrile
research compound
1,1,2,2,3,4,5,6,7,8-decadeuterioacenaphthylene
Deuterated analytical reference standard
5-hydroxypyridine-2-carboxylic acid
research compound
1,2-DICHLOROETHYLENE-D2
deuterated chemical research standard
1,2-Ethane-1,1,2,2-d4-diol
deuterated solvent or reference standard
Ethane-1,2-diol;2-hydroxyacetic acid
polyethylene glycol diacid precursor
에틸렌 글라이콜
antifreeze and polyester fiber raw material
(1,1,2,2-2H4)Ethane-1,2-(2H2)diol(CAS 15054-86-1)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,1,2,2-tetradeuterio-1,2-dideuteriooxyethane
LYCAIKOWRPUZTN-UFSLNRCZSA-N
[2H]C([2H])(C([2H])([2H])O[2H])O[2H]
(1,1,2,2-2H4)Ethane-1,2-(2H2)diol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.