This compound is a perdeuterated form of ethylene glycol, specifically labeled with deuterium atoms at all hydrogen positions. It is primarily used as a deuterated NMR standard in research laboratories for calibrating or referencing nuclear magnetic resonance experiments.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 15054-86-1
(2Z)-[(4S)-4-Phenyl-4,5-dihydro-1,3-oxazol-2-yl][(4S)-4-phenyl-1,3-oxazolidin-2-ylidene]acetonitrile
research compound
1,1,2,2,3,4,5,6,7,8-decadeuterioacenaphthylene
Deuterated analytical reference standard
5-hydroxypyridine-2-carboxylic acid
research compound
1,2-DICHLOROETHYLENE-D2
deuterated chemical research standard
1,2-Ethane-1,1,2,2-d4-diol
deuterated solvent or reference standard
Ethane-1,2-diol;2-hydroxyacetic acid
polyethylene glycol diacid precursor
에틸렌 글라이콜
antifreeze and polyester fiber raw material
1,1,2,2-tetradeuterio-1,2-dideuteriooxyethane
LYCAIKOWRPUZTN-UFSLNRCZSA-N
[2H]C([2H])(C([2H])([2H])O[2H])O[2H]