Dimethyl sulfoxide-d6 is a deuterated form of dimethyl sulfoxide (DMSO), an organosulfur compound widely used as a polar aprotic solvent. Its primary significance lies in its role as a deuterated solvent for NMR spectroscopy, enabling clear analysis of organic compounds without solvent signal interference.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Dimethyl sulfoxide-d6 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methyl Alcohol-d4
deuterated solvent for NMR spectroscopy
2,5,8,11,14,17,20,23,26,29,32,35-Dodecaoxaoctatriacontan-38-oic acid succinimidyl ester
PEG-based crosslinking reagent
2-(2-bromophenyl)naphthalene
research chemical
Naphthalene, 2-(4-chlorophenyl)-
research compound
3-BROMO-7-CHLORO-FURO[2,3-C]PYRIDINE
research compound
Dimethyl sulfoxide
Industrial solvent and reaction medium
Dimethyl sulfoxide-d6(CAS 2206-27-1)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
trideuterio(trideuteriomethylsulfinyl)methane
IAZDPXIOMUYVGZ-WFGJKAKNSA-N
[2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
Dimethyl sulfoxide-d6 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.