This compound is a polyethylene glycol (PEG)-based crosslinking reagent containing a succinimidyl ester group for conjugation with amine-functionalized molecules or surfaces. It is a highly flexible, non-aromatic heterocycle with numerous ether linkages, typically used in bioconjugation and surface modification applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Bis-PEG9-NHS ester
bifunctional PEG crosslinking reagent
Bis-PEG6-NHS ester
bifunctional crosslinking reagent
Bis-PEG1-NHS ester
Bifunctional crosslinking reagent for bioconjugation
2-(2-bromophenyl)naphthalene
research chemical
Naphthalene, 2-(4-chlorophenyl)-
research compound
3-BROMO-7-CHLORO-FURO[2,3-C]PYRIDINE
research compound
1,2,3-benzothiadiazole-6-carboxylic acid
research compound
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate
ZMXRHHJWXLKMTL-UHFFFAOYSA-N
COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.