2-(Methyl-d3)-phenylboronic acid is a deuterated research compound where the methyl group is labeled with deuterium. This isotopic labeling makes it useful as a stable isotope internal standard or tracer in analytical chemistry and metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-(Methyl-d3)-phenylboronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
RUCL2[(S)-XYLBINAP][(S,S)-DPEN]
asymmetric hydrogenation catalyst
RuCl2[(R)-xylbinap][(R)-daipen]
asymmetric hydrogenation catalyst
[1-[2-bis(3,5-dimethylphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis(3,5-dimethylphenyl)phosphane;dichlororuthenium;(1R,2R)-1,2-diphenylethane-1,2-diamine
asymmetric hydrogenation catalyst
3,5-DI-TERT-BUTYL-4-HYDROXYCINNAMIC ACID
research compound
2-methylphenyl boronic acid
research compound
[2-(trideuteriomethyl)phenyl]boronic acid
NSJVYHOPHZMZPN-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CC=CC=C1B(O)O
—
2-(Methyl-d3)-phenylboronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.