3,5-Di-tert-butyl-4-hydroxycinnamic acid is a research compound featuring a phenolic hydroxyl group and a conjugated carboxylic acid moiety. It is primarily supplied as a laboratory reagent for chemical and biochemical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 22014-01-3
3,5-Difluorobenzyl chloride
Research compound
(3aR,4S,6R,6aS)-6-((5-amino-6-chloro-2-(propylthio)pyrimidin-4-yl)amino)-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol
Pharmaceutical impurity reference standard
Bis((4-(2-benzoyl-4-chlorophenyl)-5-methyl-4H-1,2,4-triazol-3-yl)methyl)amine
research compound
2,2-Bis(3-(3-aminobenZoylamino)-4-hydroxyphenyl)hexafluoropropane
research compound
(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid
CTYWXRDQWMRIIM-BQYQJAHWSA-N
CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)/C=C/C(=O)O
—