Phenyl-d5-boronic acid is a deuterated research reagent in which the five hydrogen atoms on the phenyl ring are replaced by deuterium. It is primarily used in synthetic chemistry as a labeled building block for the preparation of deuterated organic compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 215527-70-1
3-[4-methyl-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid
research reagent for kinase inhibition
(3S)-3-aminoazepan-2-one
research compound
4-Acetamidobenzenesulfonyl azide
sulfonyl azide reagent
3-Isopropylbenzeneboronic acid
chemical intermediate for synthesis
Phenylboronic acid
n.a
(2,3,4,5,6-pentadeuteriophenyl)boronic acid
HXITXNWTGFUOAU-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])B(O)O)[2H])[2H]