3-Isopropylbenzeneboronic acid is a research reagent used as a chemical intermediate in organic synthesis. It features an aromatic ring and two hydroxyl groups on the boron atom, making it suitable for cross-coupling reactions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 216019-28-2
2-bromo-3-nitrothiophene
research compound
Methyl beta-alanyl-L-histidinate
research compound for biochemical studies
6-chloro-1,2,3,4-tetrahydroquinolin-4-one
research compound
(E)-N-(4-(4-amino-3-(5-chloro-3-methylbenzofuran-2-yl)-7-oxo-6,7-dihydro-2H-pyrazolo[3,4-d]pyridazin-2-yl)phenyl)-4-(dimethylamino)but-2-enamide
research compound
(3-propan-2-ylphenyl)boronic acid
QSWLFBMVIGQONC-UHFFFAOYSA-N
B(C1=CC(=CC=C1)C(C)C)(O)O