Fmoc-beta-(2-quinolyl)-Ala-OH is a research reagent used as an amino acid building block. It features a fluorenylmethoxycarbonyl (Fmoc) protecting group and a quinoline ring, making it suitable for solid-phase peptide synthesis and medicinal chemistry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 214852-56-9
Benzyl (S)-6-(Boc-amino)-2-(Fmoc-amino)hexanoate
amino acid building block
2,6-difluoro-4-Hydroxybenzoic Acid
research compound
1-azido-2-(2-methoxyethoxy)ethane
Click chemistry azide reagent
Phenyl-d5-boronic acid
deuterated research reagent
3-[4-methyl-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid
research reagent for kinase inhibition
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-2-ylpropanoic acid
IDOMHXAHHXHYMO-VWLOTQADSA-N
C1=CC=C2C(=C1)C=CC(=N2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35