This compound is a synthetic hexapeptide derivative used as a research reagent. Its structure includes multiple amino acid residues and an ethylamide group, with high polarity and multiple hydrogen bond donors and acceptors.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(D-LEU6,PRO-NHET9)-LHRH (4-9) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Leuprolide (5-9)
active pharmaceutical ingredient
2,6-Bis(4-azidobenzylidene)cyclohexanone
photoaffinity labeling reagent
2-BROMOBUTANE-D9
Deuterated research compound
3,4-Dimethoxybenzonitrile
research compound
(+/-)-1,2-Propylene-d6 Oxide
Deuterated reference standard for NMR
(2S)-1-[(2S)-2-[[(2S)-2-[[(2R)-2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide
GLCZVWJJUYVLEG-CKJBBXNYSA-N
CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CC2=CC=C(C=C2)O)NC(=O)[C@H](CO)N
(D-LEU6,PRO-NHET9)-LHRH (4-9) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.