This compound is a photoaffinity labeling reagent featuring two azide groups attached to aromatic rings, which can be activated by light to form covalent bonds with target biomolecules. It is primarily used in research to study molecular interactions and identify binding sites on proteins.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 20237-98-3
(2E,6E)-2,6-bis[(4-azidophenyl)methylidene]cyclohexan-1-one
UZNOMHUYXSAUPB-UNZYHPAISA-N
C1C/C(=C\C2=CC=C(C=C2)N=[N+]=[N-])/C(=O)/C(=C/C3=CC=C(C=C3)N=[N+]=[N-])/C1
—