This compound is a pharmaceutical intermediate used in the synthesis of bilastine, a second-generation antihistamine. It features a sulfonate ester group and an oxazole ring, contributing to its role in pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-CHLORO-4-(3-FLUOROBENZYLOXY)ANILINE
pharmaceutical intermediate
L-Isocitric acid
pharmaceutical intermediate
4-Nitrothalidomide, (S)-
pharmaceutical impurity standard
C-6-Cl-ddG
Pharmaceutical intermediate for carbocyclic nucleosides
2-[4-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]phenyl]ethyl 4-methylbenzenesulfonate
BGUOPDZOVDIWLE-UHFFFAOYSA-N
CC1=CC=C(C=C1)S(=O)(=O)OCCC2=CC=C(C=C2)C(C)(C)C3=NC(CO3)(C)C
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.