This compound is a pharmaceutical intermediate featuring a chloro-substituted aniline core with a fluorobenzyl ether side chain. It is primarily used in the synthesis of more complex active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 202197-26-0
L-Isocitric acid
pharmaceutical intermediate
4-Nitrothalidomide, (S)-
pharmaceutical impurity standard
C-6-Cl-ddG
Pharmaceutical intermediate for carbocyclic nucleosides
6,7-Dimethoxy-3,4-dihydroisoquinoline hydrochloride
Pharmaceutical intermediate
3-chloro-4-[(3-fluorophenyl)methoxy]aniline
AYPFEYDGZDPAPE-UHFFFAOYSA-N
C1=CC(=CC(=C1)F)COC2=C(C=C(C=C2)N)Cl