Adenosine-1'-13C is a labeled reference standard of adenosine, where the carbon atom at the 1' position of the ribose moiety is replaced with the stable isotope carbon-13. This compound is used primarily as an analytical reference material for quantification and identification in research settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Adenosine-1'-13C 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Aminobenzoic Acid-d4
labeled reference standard
2-PHENYLPROPANE-1,1,1,3,3,3-D6
deuterated research standard
Ethyl 3-(2-bromophenyl)-2-oxopropanoate
Research chemical reagent
2-(dimethylamino)ethyl 2-(m-tolyloxy)acetate
research compound
(5-Cyano-1H-indol-1-yl)acetic acid
Research compound
9-beta-D-Ribofuranosyl-9H-purin-6-amine-15N
Isotopically labeled research compound
Adenosine-5'-13C
isotopic labeled reference standard
Vidarabine
active pharmaceutical ingredient
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)(213C)oxolane-3,4-diol
OIRDTQYFTABQOQ-OGIWRBOVSA-N
C1=NC(=C2C(=N1)N(C=N2)[13C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N
Adenosine-1'-13C 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.