Adenosine-5'-13C is an isotopically labeled reference standard of adenosine, used primarily in analytical and research applications where precise quantification or tracing is required. The compound contains a carbon-13 isotope at the 5' position, making it suitable for mass spectrometry and nuclear magnetic resonance studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Adenosine-5'-13C 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methyl 2-bromohexanoate
research compound
1,1-Cyclobutanedicarboxylic acid
Research reagent and building block
2-Bromo-4-ethylpyridine
research compound
4-chloro-2,3,5,6-tetradeuterio-benzenesulfonyl chloride
deuterated research reagent
Vidarabine
active pharmaceutical ingredient
아데노신
active pharmaceutical ingredient
Adenosine-2'-13C
research reagent
Adenosine-3'-13C
research compound
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxy(113C)methyl)oxolane-3,4-diol
OIRDTQYFTABQOQ-XUZOCFOZSA-N
C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)[13CH2]O)O)O)N
Adenosine-5'-13C 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.