6-Aza-ump is a phosphorylated derivative of 6-azauridine, functioning as a nucleotide analog. It is primarily used as a research compound in biochemical and pharmacological studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
6-Aza-ump 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-Acetyl-L-phenylalanine
research compound for crystallography studies
4-(Diphenylamino)phenylboronic acid (contains varying amounts of Anhydride)
Organic synthesis and materials research reagent
1-bromonaphthalen-2-amine
research compound
Adenosine-1'-13C
labeled reference standard
[(2R,3S,4R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate
LRVZOSYMNMNQFR-SHUUEZRQSA-N
C1=NN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)O)O)O
6-Aza-ump 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.