This compound is a lithium salt of a thiazole-containing amino acid derivative, used as a pharmaceutical intermediate. Its structure features a stereocenter and an aromatic heterocyclic ring, making it suitable for incorporation into complex synthetic pathways.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 201409-23-6
N-((N-Methyl-N-((2-isopropyl-4-thiazolyl)methyl)amino)carbonyl)-L-valine Methyl Ester
analytical reference standard
3-((Acetamidomethyl)sulfanyl)-N-(((9H-fluoren-9-yl)methoxy)carbonyl)-L-valine
Fmoc-protected amino acid for peptide synthesis
Fmoc-Pen(Trt)-OH
Peptide synthesis building block
Diethyl dichloromalonate
pharmaceutical intermediate
N-Acetyl-S-(2-carboxyethyl)-L-cysteine Bis(dicyclohexylamine) Salt
N-acetylcysteine impurity reference standard
Ureidovaline
n.a
lithium (2S)-3-methyl-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoate
GXHCKLLMMZHJOG-MERQFXBCSA-M
[Li+].CC(C)C1=NC(=CS1)CN(C)C(=O)N[C@@H](C(C)C)C(=O)[O-]