Fmoc-Pen(Trt)-OH is a synthetic building block used in peptide chemistry. It is a protected derivative of penicillamine, featuring an Fmoc group for temporary amino protection and a trityl (Trt) group for side-chain thiol protection, making it suitable for solid-phase peptide synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 201531-88-6
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylbutanoic acid
Fmoc-protected amino acid for peptide synthesis
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-alanine
Peptide synthesis building block
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)triphenyl-L-methionine
Peptide synthesis building block
N-alpha-(9-Fluorenylmethyloxycarbonyl)-N-beta-trityl-D-asparagine
Peptide synthesis building block
N-Fmoc-(2S,3S)-3-amino-2-hydroxy-4-phenyl-butyric acid
Peptide synthesis building block
Diethyl dichloromalonate
pharmaceutical intermediate
N-Acetyl-S-(2-carboxyethyl)-L-cysteine Bis(dicyclohexylamine) Salt
N-acetylcysteine impurity reference standard
(R)-N-[5-(2-Bromo-1-hydroxyethyl)-2-(phenylmethoxy)phenyl]formamide
Pharmaceutical intermediate
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-3-tritylsulfanylbutanoic acid
XSGMGAINOILNJR-PGUFJCEWSA-N
CC(C)([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)SC(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6