This compound is an organic molecule used as a pharmaceutical intermediate. It features a complex structure with multiple amide and aromatic groups, indicating its role as a building block in drug manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 200575-15-1
H-D-Glu-OtBu HCl
peptide synthesis building block
N-Fmoc-N'-trityl-D-glutamine
Peptide synthesis building block
Eldecalcitol interMediates
Eldecalcitol synthetic intermediate
(S)-tert-Butyl oxirane-2-carboxylate
chiral building block for synthesis
4-[[2-ethoxy-5-(4-methylpiperazin-1-yl)sulfonylbenzoyl]amino]-1-methyl-3-propylpyrazole-5-carboxamide
IFFGTBBYPRZJLD-UHFFFAOYSA-N
CCCC1=NN(C(=C1NC(=O)C2=C(C=CC(=C2)S(=O)(=O)N3CCN(CC3)C)OCC)C(=O)N)C