This compound is a synthetic intermediate specifically used in the production of eldecalcitol, a vitamin D analog. It features a cyclohexylidene ethanol core with multiple tert-butyl(dimethyl)silyl protecting groups, which are common in multi-step pharmaceutical synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Eldecalcitol interMediates 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(S)-tert-Butyl oxirane-2-carboxylate
chiral building block for synthesis
Ethyl 3-(2-methoxyphenyl)-2-oxopropanoate
Pharmaceutical intermediate for synthesis
1-(2-Chloroethyl)piperidine hydrochloride
Pharmaceutical intermediate
2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol
Pharmaceutical intermediate for tolterodine synthesis
Cyclohexane, 1,2-bis(methylene)-
chemical intermediate
(Z)-2-((3S,5R)-3,5-bis((tert-butyldiMethylsilyl)oxy)-2-Methylenecyclohexylidene)ethanol
n.a
Elastase
Proteolytic enzyme for research
(3Z)-3-(3-methylbut-2-enylidene)-4-methylidenecyclohexan-1-ol
Reactive dye
(2Z)-2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-methylidenecyclohexylidene]ethanol
LKDMRCVDAOOZGO-JZEAMISTSA-N
CC(C)(C)[Si](C)(C)OCCCO[C@@H]1[C@@H](C/C(=C/CO)/C(=C)[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C
Eldecalcitol interMediates 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.