6-Nitroindoline is a research reagent used as a precursor in the synthesis of caged neurotransmitter compounds, such as caged glutamate derivatives that release the active neurotransmitter upon light exposure. It serves as a structural building block for photolabile probes employed in neuroscience studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
6-Nitroindoline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Z-Thr-OH
research compound
3-O-(2-methoxyethyl) 5-O-[(E)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrosophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
Nitrosamine impurity reference standard
2-Methyl-4-nitrobenzoic acid
research compound
5-ethyl-1,2-oxazol-3-amine
research reagent
Indoline-5,6-diol
research compound
인돌린
research compound
Carbazochrome sodium sulfonate
hemostatic agent
1-Amino-2-methylindoline hydrochloride
Pharmaceutical intermediate for indoline derivatives
6-Nitroindoline(CAS 19727-83-4)의 국제 HS 코드는 2933.99입니다.
2933.99
2933 99 80
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
6-nitro-2,3-dihydro-1H-indole
LTNYDSMDSLOMSM-UHFFFAOYSA-N
C1CNC2=C1C=CC(=C2)[N+](=O)[O-]
6-Nitroindoline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.