Z-Thr-OH is a protected derivative of the amino acid threonine, commonly used as a research compound in peptide synthesis and biochemical studies. It features a benzyloxycarbonyl (Z) protecting group attached to the amino terminus, facilitating selective incorporation into oligopeptides.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Z-Thr-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-Carbobenzyloxy-L-valine
peptide synthesis reagent
Cbz-L-Isoleucine dicyclohexylamine salt
protected amino acid building block
N-[(Phenylmethoxy)carbonyl]-L-isoleucine
protected amino acid intermediate
3-O-(2-methoxyethyl) 5-O-[(E)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrosophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
Nitrosamine impurity reference standard
2-Methyl-4-nitrobenzoic acid
research compound
5-ethyl-1,2-oxazol-3-amine
research reagent
2-Bromo-3-nitropyridine
research reagent
Z-Thr-OH(CAS 19728-63-3)의 국제 HS 코드는 2924.29입니다.
2924.29
2924 29 70
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid
IPJUIRDNBFZGQN-SCZZXKLOSA-N
C[C@H]([C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1)O
Z-Thr-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.