This compound is a synthetic peptide used as an active pharmaceutical ingredient in pharmaceutical research and manufacturing. Its structure includes multiple amino acid residues, amide bonds, and aromatic rings, contributing to its complex molecular architecture.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
[1-(5-oxo-D-proline)]buserelin 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(Des-Gly10,D-Trp3,D-Leu6,Pro-NHEt9)-LHRH Trifluoroacetate
LHRH analog active pharmaceutical ingredient
Leuprolide EP impurity D
reference standard for pharmaceutical impurity
Goserelin Impurity G
goserelin impurity reference standard
(D-Ser(tBu)6,D-Leu7,Azagly10)-LHRH
LHRH analog peptide
Buserelin EP Impurity B
Active pharmaceutical ingredient reference standard
Etilamide
GnRH agonist therapeutic peptide
Buserelin acetate
active pharmaceutical ingredient
(Des-Gly10,D-Tyr5,D-Ser(tBu)6,Pro-NHEt9)-LHRH Acetate
LHRH agonist therapeutic peptide
(2R)-N-[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2R)-1-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(2S)-2-(ethylcarbamoyl)pyrrolidin-1-yl]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-5-oxopyrrolidine-2-carboxamide
CUWODFFVMXJOKD-UUVJJVFOSA-N
CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](COC(C)(C)C)NC(=O)[C@H](CC2=CC=C(C=C2)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC3=CNC4=CC=CC=C43)NC(=O)[C@H](CC5=CN=CN5)NC(=O)[C@H]6CCC(=O)N6
[1-(5-oxo-D-proline)]buserelin 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.