Buserelin EP Impurity B is a peptide compound used as a reference standard in quality control for the active pharmaceutical ingredient buserelin. It is structurally complex, featuring multiple amino acid residues, amide bonds, and functional groups such as an alcohol, ether, and aromatic rings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Buserelin EP Impurity B 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(1R)-1-(3,4-Dihydroxyphenyl)-2-methylaminoethanesulphonic acid
Active pharmaceutical ingredient reference standard
(Des-Gly10,D-Trp3,D-Leu6,Pro-NHEt9)-LHRH Trifluoroacetate
LHRH analog active pharmaceutical ingredient
Leuprolide EP impurity D
reference standard for pharmaceutical impurity
Goserelin Impurity G
goserelin impurity reference standard
(D-Ser(tBu)6,D-Leu7,Azagly10)-LHRH
LHRH analog peptide
Etilamide
GnRH agonist therapeutic peptide
Buserelin acetate
active pharmaceutical ingredient
(Des-Gly10,D-Tyr5,D-Ser(tBu)6,Pro-NHEt9)-LHRH Acetate
LHRH agonist therapeutic peptide
(2S)-N-[(2S)-1-[[(2S)-1-[[(2R)-1-[[(2S)-1-[[(2R)-1-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(2S)-2-(ethylcarbamoyl)pyrrolidin-1-yl]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-5-oxopyrrolidine-2-carboxamide
CUWODFFVMXJOKD-NGLXBDFUSA-N
CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](COC(C)(C)C)NC(=O)[C@H](CC2=CC=C(C=C2)O)NC(=O)[C@@H](CO)NC(=O)[C@H](CC3=CNC4=CC=CC=C43)NC(=O)[C@H](CC5=CN=CN5)NC(=O)[C@@H]6CCC(=O)N6
Buserelin EP Impurity B 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.