Boc-Tyr-OtBu is a protected derivative of the amino acid tyrosine, commonly used as a building block in peptide synthesis. Its structure incorporates tert-butoxycarbonyl (Boc) and tert-butyl ester (OtBu) protecting groups, making it suitable for solid-phase or solution-phase peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Boc-Tyr-OtBu 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Boc-Tyr-OMe
Peptide synthesis intermediate
Ethyl N-(tert-butoxycarbonyl)-L-tyrosinate
protected amino acid intermediate
L-Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]-
Protected amino acid for peptide synthesis
Boc-ser(tbu)-oh dcha
protected amino acid intermediate
Sodium chlorodifluoroacetate
Pharmaceutical intermediate for synthesis
(S)-2-Methyl-1-(6-nitropyridin-3-yl)piperazine
pharmaceutical intermediate
18-(benzyloxy)-18-oxooctadecanoic acid
Pharmaceutical intermediate for synthesis
tert-butyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
WGJGINMQCMATNP-AWEZNQCLSA-N
CC(C)(C)OC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)OC(C)(C)C
Boc-Tyr-OtBu 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.