6-Chloro-2-methyl-2H-indazol-5-amine is a chemical compound used as a pharmaceutical intermediate. It features a substituted indazole ring system with an amino group and a chlorine atom, contributing to its utility in the synthesis of more complex molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
6-Chloro-2-methyl-2H-indazol-5-amine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Tert-Butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate
Pharmaceutical intermediate
Tert-Butyl (4R)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate
Pharmaceutical intermediate
Ethyl (2R,3S)-2-(4-(cyclopentylamino)phenyl)piperidine-3-carboxylate bis((2R,3R)-2,3-bis((4-methylbenzoyl)oxy)succinate)
pharmaceutical intermediate for anticoagulants
Boc-Tyr-OtBu
Pharmaceutical intermediate for peptide synthesis
6-chloro-2-methylindazol-5-amine
YRZNRFJEBAPCCO-UHFFFAOYSA-N
CN1C=C2C=C(C(=CC2=N1)Cl)N
6-Chloro-2-methyl-2H-indazol-5-amine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.