Z-VAD-fmk is a research reagent used as a pan-caspase inhibitor. It is a fluoromethylketone derivative that contains an aromatic ring and multiple amide bonds, commonly employed in laboratory studies to investigate apoptosis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 187389-52-2
2,4-Dichlorothieno[2,3-d]pyrimidine
Research reagent
1-(3-fluorophenyl)-2-((2-hydroxyethyl)amino)propan-1-ol
Organic synthesis research reagent
3-Nitrophenylacetic acid
organic synthesis intermediate herbicidal reagent
2-[[(2S)-2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetic acid
research compound
methyl (3S)-5-fluoro-3-[[(2S)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoyl]amino]-4-oxopentanoate
MIFGOLAMNLSLGH-QOKNQOGYSA-N
C[C@@H](C(=O)N[C@@H](CC(=O)OC)C(=O)CF)NC(=O)[C@H](C(C)C)NC(=O)OCC1=CC=CC=C1