3-Nitrophenylacetic acid is an organic compound used in organic synthesis and as a herbicidal reagent. It is a derivative of phenylacetic acid containing a nitro group on the aromatic ring, and serves as a key intermediate in the formation of heterocyclic compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1877-73-2
2-[[(2S)-2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetic acid
research compound
4-Bromophenylacetic acid
monocarboxylic acid research reagent
1-Bromooctadecane-d37
deuterated research compound
Acetylcorynoline
reference standard for alkaloid analysis
2-(3-nitrophenyl)acetic acid
WUKHOVCMWXMOOA-UHFFFAOYSA-N
C1=CC(=CC(=C1)[N+](=O)[O-])CC(=O)O