10-Phenyldecanoic acid is a long-chain fatty acid derivative featuring a phenyl group attached to the terminal carbon. It is primarily used as an intermediate in pharmaceutical research and manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
10-Phenyldecanoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
11-Phenylundecanoic acid
Research compound for lipid studies
12-Phenyllauric acid
research compound
9-Phenylnonanoic acid
medium-chain fatty acid research compound
4-PHENYLBUTYRIC ACID
Histone deacetylase inhibitor
3-(Trifluoromethoxy)phenylboronic acid (contains varying amounts of Anhydride)
Pharmaceutical research intermediate
4,5-DIHYDRO-5-METHYL-3,4-DIPHENYL-5-ISOXAZOLOL
Pharmaceutical research intermediate
Ethyl 5-formyl-2,4-dimethyl-1H-pyrrole-3-carboxylate
Pharmaceutical research intermediate
(R)-2'-Oxo-1',2',5,7-tetrahydrospiro[cyclopenta[b]pyridine-6,3'-pyrrolo[2,3-b]pyridine]-3-carboxylic acid
Pharmaceutical research intermediate
10-phenyldecanoic acid
IISIYJPTBDSIFM-UHFFFAOYSA-N
C1=CC=C(C=C1)CCCCCCCCCC(=O)O
10-Phenyldecanoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.