This compound is a boronic acid derivative featuring a trifluoromethoxy substituent on the aromatic ring, commonly used as an intermediate in pharmaceutical research. It is typically supplied with varying amounts of anhydride, reflecting its utility in synthetic chemistry applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 179113-90-7
10-Phenyldecanoic acid
Pharmaceutical research intermediate
4,5-DIHYDRO-5-METHYL-3,4-DIPHENYL-5-ISOXAZOLOL
Pharmaceutical research intermediate
Ethyl 5-formyl-2,4-dimethyl-1H-pyrrole-3-carboxylate
Pharmaceutical research intermediate
(R)-2'-Oxo-1',2',5,7-tetrahydrospiro[cyclopenta[b]pyridine-6,3'-pyrrolo[2,3-b]pyridine]-3-carboxylic acid
Pharmaceutical research intermediate
1-Chloro-4-methoxybutane
pharmaceutical intermediate
4-[5-[4-(Pentyloxy)phenyl]-3-isoxazolyl]benzoic acid
Pharmaceutical intermediate
4-Bromo-2-fluoro-benzoic acid methyl ester
Pharmaceutical intermediate
3-aminoazepan-2-one
pharmaceutical intermediate
[3-(trifluoromethoxy)phenyl]boronic acid
UWDFWVLAHRQSKK-UHFFFAOYSA-N
B(C1=CC(=CC=C1)OC(F)(F)F)(O)O
—