2,4-Difluoro-3-methoxybenzoic acid is a fluorinated aromatic carboxylic acid used as a building block in pharmaceutical manufacturing. It features a benzoic acid core substituted with two fluorine atoms and a methoxy group, which contribute to its chemical properties as a pharmaceutical intermediate.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 178974-97-5
L-Aspartic acid, bis(1,1-dimethylethyl) ester, hydrochloride
pharmaceutical intermediate for peptide synthesis
3-(Trifluoromethoxy)phenylboronic acid (contains varying amounts of Anhydride)
Pharmaceutical research intermediate
1-Chloro-4-methoxybutane
pharmaceutical intermediate
4-[5-[4-(Pentyloxy)phenyl]-3-isoxazolyl]benzoic acid
Pharmaceutical intermediate
2,4-difluoro-3-methoxybenzoic acid
KWLIGHXPUYUTBH-UHFFFAOYSA-N
COC1=C(C=CC(=C1F)C(=O)O)F
—