2-Amino-5-nitrobenzophenone is a chemical compound used as a synthetic precursor in the production of nitrazepam, a benzodiazepine-class hypnotic agent with sedative, anxiolytic, and anticonvulsant properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1775-95-7
Tert-butyl N-[4-(aminomethyl)cyclohexyl]carbamate
Boc-protected amine intermediate
5-methyl-1H-indazole
pharmaceutical intermediate
4-Aminocyclohexanecarboxylic acid
pharmaceutical intermediate
2-(3-hydroxyadamantan-1-yl)acetic acid
Pharmaceutical intermediate
5-Amino-2-nitrobenzophenone-d5
Nitrazepam impurity reference standard
(2-amino-5-nitrophenyl)-phenylmethanone
PZPZDEIASIKHPY-UHFFFAOYSA-N
C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)[N+](=O)[O-])N