This compound is a Boc-protected amine intermediate, featuring a cyclohexane ring with an aminomethyl substituent. It is primarily used in pharmaceutical manufacturing as a building block for the synthesis of more complex molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 177583-27-6
Tert-Butyl (3-(aminomethyl)cyclobutyl)carbamate
research compound for medicinal chemistry
Tert-butyl (piperidin-4-ylmethyl)carbamate
Boc-protected amine intermediate
5-methyl-1H-indazole
pharmaceutical intermediate
4-Aminocyclohexanecarboxylic acid
pharmaceutical intermediate
2-(3-hydroxyadamantan-1-yl)acetic acid
Pharmaceutical intermediate
5-Amino-2,4-ditert-butylphenol HCL
pharmaceutical intermediate
tert-butyl N-[4-(aminomethyl)cyclohexyl]carbamate
NVQFOBONHIXDOC-UHFFFAOYSA-N
CC(C)(C)OC(=O)NC1CCC(CC1)CN
—