This compound is a morpholine-based pharmaceutical intermediate containing multiple fluorine atoms and a chiral center. It is primarily used in the synthesis of active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 171482-05-6
4-Methylbenzene-1-sulfonic acid--(2R,3S)-2-((1R)-1-(3,5-bis(trifluoromethyl)phenyl)ethoxy)-3-(4-fluorophenyl)morpholine (1/1)
pharmaceutical intermediate
2-((1R)-1-(3,5-Bis(trifluoromethyl)phenyl)ethoxy)-3-(4-fluorophenyl) morpholine, (2R,3S)-
Nitrosamine impurity reference standard
2'-O-Propargyl g(iBu)-3'-phosphoramidite
phosphoramidite building block for oligonucleotide synthesis
2'-propargyl U amidite
RNA synthesis phosphoramidite building block
Chloropretadalafil
pharmaceutical intermediate
8-Bromo-2'-benzamido-2'-deoxy-Adenosine
adenosine impurity reference standard
(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine;hydrochloride
DWCCMKXSGCKMJF-YNXGUESPSA-N
C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O[C@@H]2[C@@H](NCCO2)C3=CC=C(C=C3)F.Cl