Chloropretadalafil is a chemical compound used as a pharmaceutical intermediate, primarily in research and manufacturing settings. It features a complex polycyclic structure with multiple aromatic rings and functional groups including an amide, ester, and ether linkages.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Chloropretadalafil 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
8-Bromo-2'-benzamido-2'-deoxy-Adenosine
adenosine impurity reference standard
Ethyl 4-oxocyclohexanecarboxylate
Pharmaceutical intermediate for drug synthesis
Ethyl 4-hydroxycyclohexanecarboxylate
pharmaceutical intermediate
Methyl 3-(3-(((tert-butoxycarbonyl)amino)methyl)phenyl)propanoate
Pharmaceutical intermediate for synthesis
Methyl (1R,3R)-1-(benzo[d][1,3]dioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate hydrochloride
pharmaceutical intermediate
Chloropretadalafil(CAS 171489-59-1)의 국제 HS 코드는 2934.99입니다.
2934.99
2934 99 90
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
methyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate
JUKHNCNDFOAFLT-IIBYNOLFSA-N
COC(=O)[C@H]1CC2=C([C@H](N1C(=O)CCl)C3=CC4=C(C=C3)OCO4)NC5=CC=CC=C25
Chloropretadalafil 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.