Chloropretadalafil is a chemical compound used as a pharmaceutical intermediate, primarily in research and manufacturing settings. It features a complex polycyclic structure with multiple aromatic rings and functional groups including an amide, ester, and ether linkages.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 171489-59-1
8-Bromo-2'-benzamido-2'-deoxy-Adenosine
adenosine impurity reference standard
Ethyl 4-oxocyclohexanecarboxylate
Pharmaceutical intermediate for drug synthesis
Ethyl 4-hydroxycyclohexanecarboxylate
pharmaceutical intermediate
Methyl 3-(3-(((tert-butoxycarbonyl)amino)methyl)phenyl)propanoate
Pharmaceutical intermediate for synthesis
Methyl (1R,3R)-1-(benzo[d][1,3]dioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate hydrochloride
pharmaceutical intermediate
methyl (1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate
JUKHNCNDFOAFLT-IIBYNOLFSA-N
COC(=O)[C@H]1CC2=C([C@H](N1C(=O)CCl)C3=CC4=C(C=C3)OCO4)NC5=CC=CC=C25