This compound is an amino acid derivative featuring a biphenyl side chain. It serves as a pharmaceutical intermediate, particularly employed in the synthesis of peptides for research and manufacturing applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2R)-2-Amino-3-((1,1'-biphenyl)-4-yl)propanoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
L-Phenylalanine-1,2,3,4,5,6-13C6
isotope-labeled research reagent
페닐알라닌
nutritional supplement and flavoring agent
D-phenylalanine
Antidepressant pharmaceutical ingredient
DL-PHENYLALANINE
nutrient and flavoring agent
(R)-3-(4-Phenoxyphenyl)-1-(piperidin-3-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine dihydrochloride
pharmaceutical intermediate
2-(2,4-Dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolane-4-methanol, (2R,4S)-(+-)--
Pharmaceutical intermediate for antifungal agents
Butanedioic acid, 2,3-bis(benzoyloxy)-, (2S,3S)-
chiral resolution agent
Vipivotide tetraxetan Linker
PSMA-targeted ligand-linker conjugate intermediate
(2R)-2-amino-3-(4-phenylphenyl)propanoic acid
JCZLABDVDPYLRZ-CQSZACIVSA-N
C1=CC=C(C=C1)C2=CC=C(C=C2)C[C@H](C(=O)O)N
(2R)-2-Amino-3-((1,1'-biphenyl)-4-yl)propanoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.