tert-butyl (2R)-2-methylpiperazine-1-carboxylate is a chemical compound used as a pharmaceutical intermediate. It features a piperazine ring with a tert-butoxycarbonyl (Boc) protective group and a methyl substituent, making it valuable in drug synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 170033-47-3
Tert-butyl (3R,4S)-3-amino-4-fluoropiperidine-1-carboxylate
Pharmaceutical intermediate
(2R)-2-Amino-3-((1,1'-biphenyl)-4-yl)propanoic acid
Pharmaceutical intermediate for peptide synthesis
(R)-3-(4-Phenoxyphenyl)-1-(piperidin-3-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine dihydrochloride
pharmaceutical intermediate
2-(2,4-Dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolane-4-methanol, (2R,4S)-(+-)--
Pharmaceutical intermediate for antifungal agents
Tert-butyl (2S)-2-methylpiperazine-1-carboxylate
pharmaceutical intermediate for synthesis
tert-butyl (2R)-2-methylpiperazine-1-carboxylate
DATRVIMZZZVHMP-MRVPVSSYSA-N
C[C@@H]1CNCCN1C(=O)OC(C)(C)C