2-Amino-4-bromo-3,5-difluorobenzoic acid is a benzoic acid derivative containing amino, bromo, and difluoro substituents. It is primarily used as a research reagent in laboratory and chemical supply contexts.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1698027-86-9
Ethyl thiooxamate
research chemical
4-methyl-2-(propan-2-yl)pyridin-3-amine
research compound
Tacrolimus Impurity 9
pharmaceutical reference standard
(4S)-4-(propan-2-yl)-1,3-oxazolidin-2-one
Chiral amino alcohol derivative
2-amino-4-bromo-3,5-difluorobenzoic acid
HMEMIUSIGMVLLA-UHFFFAOYSA-N
C1=C(C(=C(C(=C1F)Br)F)N)C(=O)O
—