Tacrolimus Impurity 9 is a research reagent used as a pharmaceutical reference standard in analytical testing. It is a structurally characterized compound with a macrocyclic lactone backbone bearing multiple hydroxyl, ether, and ester functional groups, typically employed for quality control purposes.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Tacrolimus Impurity 9 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
7-Chloro-5-phenyl-1H-1,4-benzodiazepine-2,3-dione
pharmaceutical reference standard
Albendazole EP Impurity H
pharmaceutical reference standard
6-Hydroxy-5-methoxypyrimidin-4(3H)-one
pharmaceutical reference standard
Norquetiapine
pharmaceutical reference standard
(4S)-4-(propan-2-yl)-1,3-oxazolidin-2-one
Chiral amino alcohol derivative
(4S)-4-(2-methylpropyl)-1,3-oxazolidin-2-one
research compound
B-(4-(3-Pyridinyl)phenyl)boronic acid
Research chemical for organic synthesis
4-Amino-3-ethylbenzonitrile
research compound
(4R,6S,7R,8S,10S,12E,14R,17S,18R,19S,22S)-3,7,17-trihydroxy-19-[(E)-1-[(1R,3R,4R)-4-hydroxy-3-methoxycyclohexyl]prop-1-en-2-yl]-6,8-dimethoxy-4,10,12,18-tetramethyl-2,15,21-trioxo-14-prop-2-enyl-20-oxa-1-azabicyclo[20.4.0]hexacos-12-ene-3-carboxylic acid
UJYIGARKMOMKSG-ONCIHNGKSA-N
C[C@@H]1C[C@@H]([C@H]([C@H](C[C@H](C(C(=O)N2CCCC[C@H]2C(=O)O[C@@H]([C@@H]([C@H](CC(=O)[C@@H](/C=C(/C1)\C)CC=C)O)C)/C(=C/[C@@H]3CC[C@H]([C@@H](C3)OC)O)/C)(C(=O)O)O)C)OC)O)OC
Tacrolimus Impurity 9 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.