3-Chlorobromobenzene-2,4,5,6-d4 is a deuterated research compound where four hydrogen atoms on the benzene ring are replaced by deuterium. It is primarily used as a stable isotope-labeled reagent in analytical and synthetic chemistry research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-Chlorobromobenzene-2,4,5,6-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
5-bromo-2-phenyl-2H-benzo[d][1,2,3]triazole
research compound
Pyren-1-ylboronic Acid
Research reagent for boronic acid coupling
N'-[9-[(2R,4S,5S)-5-[[2-cyanoethoxy-(diisopropylamino)phosphanyl]oxymethyl]-4-(tritylamino)tetrahydrofuran-2-yl]purin-6-yl]-N,N-dimethyl-formamidine
research chemical for oligonucleotide synthesis
4-(Trifluoromethyl)phenyl isothiocyanate
isothiocyanate reagent for organic synthesis
1-Bromo-3-chlorobenzene
industrial organic synthesis intermediate
1-bromo-3-chloro-2,4,5,6-tetradeuteriobenzene
JRGGUPZKKTVKOV-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1[2H])Br)[2H])Cl)[2H]
3-Chlorobromobenzene-2,4,5,6-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.