Pyren-1-ylboronic acid is a research reagent featuring a boronic acid group attached to a pyrene core, a polycyclic aromatic hydrocarbon. This compound is primarily used in laboratory settings for boronic acid coupling reactions, particularly in the synthesis of organic materials and molecular probes.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 164461-18-1
3-(Trimethylsilyl)phenylboronic acid
Research reagent for boronic acid coupling
N'-[9-[(2R,4S,5S)-5-[[2-cyanoethoxy-(diisopropylamino)phosphanyl]oxymethyl]-4-(tritylamino)tetrahydrofuran-2-yl]purin-6-yl]-N,N-dimethyl-formamidine
research chemical for oligonucleotide synthesis
4-(Trifluoromethyl)phenyl isothiocyanate
isothiocyanate reagent for organic synthesis
Glutamic acid diethyl ester
research compound for biochemical studies
(S)-1-(3-Fluoro-4-(trifluoromethoxy)phenyl)-2-methoxyethan-1-amine hydrochloride
laboratory research chemical
1-METHYLPYRENE
Laboratory chemical and intermediate
1-HYDROXYPYRENE
Biomarker for polycyclic aromatic hydrocarbon exposure
Pyrene D10
deuterated internal standard for analysis
pyren-1-ylboronic acid
MWEKPLLMFXIZOC-UHFFFAOYSA-N
B(C1=C2C=CC3=CC=CC4=C3C2=C(C=C1)C=C4)(O)O