This compound is a protected amino acid derivative used in peptide synthesis. It features a fluorenylmethoxycarbonyl (Fmoc) protecting group on the amino terminus and a tert-butoxycarbonyl (Boc) group on the indole nitrogen, enabling selective deprotection during solid-phase peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 163619-04-3
Fmoc-Trp(N-CH2-COOtBu)-OH
research compound
Boc-Trp(Boc)-OH
Protected amino acid building block
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(1-methyl-1H-indol-3-yl)propanoic acid
Building block for peptide synthesis
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-((2-(methylthio)ethyl)amino)-2-((3,3,3-trifluoropropyl)thio)-9H-purin-9-yl)tetrahydrofuran-3,4-diol
Pharmaceutical intermediate
Tributylamine (dichloromethylene)bis(phosphonate)
pharmaceutical intermediate
Afatinib Impurity I
pharmaceutical reference standard
2'-Deoxyadenosine monohydrate
pharmaceutical intermediate
Fmoc-L-Trp(Boc)-OH
protected amino acid building block
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid
ADOHASQZJSJZBT-AREMUKBSSA-N
CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)C[C@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35