Fmoc-L-Trp(Boc)-OH is a protected amino acid derivative used as a building block in peptide synthesis. It features fluorenylmethoxycarbonyl (Fmoc) protection on the amino group and tert-butoxycarbonyl (Boc) protection on the indole nitrogen of tryptophan.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 143824-78-6
Fmoc-Trp(N-CH2-COOtBu)-OH
research compound
Boc-Trp(Boc)-OH
Protected amino acid building block
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(1-methyl-1H-indol-3-yl)propanoic acid
Building block for peptide synthesis
(2S)-5-{[(benzyloxy)carbonyl]amino}-2-{[(tert-butoxy)carbonyl]amino}pentanoic acid
protected amino acid building block
Cbz-L-Isoleucine dicyclohexylamine salt
protected amino acid building block
(R)-3-(((Benzyloxy)carbonyl)amino)-2-((tert-butoxycarbonyl)amino)propanoic acid
protected amino acid building block
Boc-3-(3-pyridyl)-Ala-OH
protected amino acid building block
Endo-8-Azabicyclo[3.2.1]octan-3-ol hydrochloride
pharmaceutical intermediate
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid
ADOHASQZJSJZBT-SANMLTNESA-N
CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35