This compound is an industrial chemical used primarily as an intermediate in the production of liquid crystals. It features a structure containing multiple rings, including an aromatic ring, and is non-polar.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(trans(trans))-4'-vinyl-4-(4-methylphenyl)bicyclohexyl 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Methylpentane-1,5-diamine
Hardener for epoxy resins
Melamine pyrophosphate
Flame retardant additive
4-(4-Bromophenyl)-6-phenyldibenzofuran
Organic electronic material intermediate
Magnesium dipropan-2-olate
catalyst precursor and chemical intermediate
(trans,trans)-4-(But-3-en-1-yl)-4'-(p-tolyl)-1,1'-bi(cyclohexane)
liquid crystal intermediate
(trans,trans)-4-(3,4-Difluorophenyl)-4'-vinyl-1,1'-bi(cyclohexane)
liquid crystal intermediate
Benzene, 1-[(trans,trans)-4'-ethyl[1,1'-bicyclohexyl]-4-yl]-2,3-difluoro-4-methyl-
liquid crystal intermediate
1-fluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene
liquid crystal intermediate
1-[4-(4-ethenylcyclohexyl)cyclohexyl]-4-methylbenzene
BCUMFFLWJNKNOU-UHFFFAOYSA-N
CC1=CC=C(C=C1)C2CCC(CC2)C3CCC(CC3)C=C
(trans(trans))-4'-vinyl-4-(4-methylphenyl)bicyclohexyl 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.