This compound is a difluorinated aromatic liquid crystal intermediate. It is primarily used in the manufacturing of liquid crystal materials for displays and optical devices.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 142400-92-8
Butyltrimethylammonium chloride
phase transfer catalyst
2-(2-Chloroethoxy)ethyl acetate
Chemical intermediate
Propanoic acid--2-ethoxyethan-1-ol (1/1)
Solvent and chemical intermediate
Methyl 6-chlorohexanoate
Chemical intermediate for synthesis
(trans(trans))-4'-vinyl-4-(4-methylphenyl)bicyclohexyl
liquid crystal intermediate
Trans,trans-4-(3,4-Difluorophenyl)-4'-propyl-1,1'-bi(cyclohexane)
liquid crystal intermediate
Benzene, 1-[(trans,trans)-4'-ethyl[1,1'-bicyclohexyl]-4-yl]-2,3-difluoro-4-methyl-
liquid crystal intermediate
(trans,trans)-4-(But-3-en-1-yl)-4'-(p-tolyl)-1,1'-bi(cyclohexane)
liquid crystal intermediate
4-[4-(4-ethenylcyclohexyl)cyclohexyl]-1,2-difluorobenzene
ALFLDQIYGBNZCO-UHFFFAOYSA-N
C=CC1CCC(CC1)C2CCC(CC2)C3=CC(=C(C=C3)F)F